![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/unknown.gif) | 3D XPoint? Scaling Strategy.pptx | 2017-11-01 06:43 | 138K | |
| 14nm JDP pathfinding definition closure.pptx | 2017-09-29 04:15 | 98K | |
| 14nm Pathfinding Performance Target.pptx | 2017-10-14 06:18 | 53K | |
| 14nm W Resistance Eval Damascene Design.xlsx | 2017-10-20 09:31 | 29K | |
| 14nm W Resistance using Pitch Quad S26A, with structure design.pptx | 2017-10-21 04:15 | 1.3M | |
| 14nm W Resistance using Pitch Quad S26A.pptx | 2017-10-18 10:17 | 1.2M | |
| 14nm W Resistance using XP03.pptx | 2017-10-15 08:18 | 1.2M | |
| 14nm pathfinding ? Definition Closure.pptx | 2017-09-28 02:31 | 91K | |
![[ ]](/icons/layout.gif) | 21nm 8Gb PCM by Samsung ISSCC 2012 D02_05.pdf | 2016-05-22 01:49 | 2.5M | |
| 25nm 16Gb PCM MLC Hynix 2015 Custom IC Conf.pdf | 2016-05-22 01:52 | 741K | |
| 30 Series Path Finding Sep-2015.pptx | 2015-09-04 00:56 | 50K | |
| 30 arch for eval 2.xlsx | 2018-01-31 14:04 | 11K | |
| 30s Architecture Strategy Sept_2015.pptx | 2015-09-28 22:20 | 125K | |
| 30s Pathfinding SOW Review - meeting minutes.msg | 2016-05-22 01:49 | 423K | |
| 30s_space_vs_20s_old.xlsx | 2015-07-27 23:49 | 327K | |
| 30s_ww16_5.pptx | 2015-05-07 03:29 | 1.2M | |
| 30 scaling strategy.xlsx | 2017-09-19 07:55 | 13K | |
| 20150317 S26A Staggered Termination Scheme - Part2.pptx | 2015-07-28 00:22 | 280K | |
| 20170803_1_sxp_energy_comparison_to_dram_energy.pptx | 2017-10-25 07:32 | 620K | |
| 20171017 S37A Energy Calculator with BL at VHH.xlsx | 2017-10-25 13:19 | 459K | |
| 20180419 Series 30 SxP SOW Version 1.9.pptx | 2018-04-25 05:16 | 368K | |
![[DIR]](/icons/folder.gif) | Architecture PF/ | 2025-07-03 10:45 | - | |
| Array Map Day.xlsx | 2018-05-08 05:48 | 23K | |
| Array Parastics and Scaling-25nm.ppt | 2010-02-27 06:52 | 896K | |
| Array Parastics and Scaling.ppt | 2009-10-25 04:09 | 122K | |
| Athmanathan, et.al., Multilevel-Cell Phase Change Memory A Viable Technology, IEEE J on emerging and selected topic in circuits and systems, V6 no. 1, Mar 2016.pdf | 2016-05-22 08:39 | 3.6M | |
| CR7.67 VT evolutions.pptx | 2017-10-18 21:28 | 1.0M | |
| Copy of Scaling.xls | 2019-02-26 04:20 | 28K | |
| DDR2-4 speed.xlsx | 2017-11-28 06:29 | 22K | |
| DTS Risk and Mitigation.xlsx | 2018-05-10 12:39 | 14K | |
| Device RARM.pptx | 2018-05-16 21:57 | 3.0M | |
| Die_Size_6_1_2015.xlsx | 2015-07-28 08:42 | 36K | |
| G. F. Close et.al., Device, circuit and system-level analysis of noise in multi-bit phase-change memory, IEDM 2010, S29P05.PDF | 2010-11-02 06:50 | 1.4M | |
| IBM PCM TLC IMW 2016.pdf | 2016-05-22 01:50 | 368K | |
| Interconnect Scaling.ppt | 2010-03-30 05:15 | 159K | |
| M. Stanisavljevic et.al., Phase-Change Memory - Feasibility of Reliable Multilevel-cell Storage and Retention at Elevated Temperatures, IRPS 2015.pdf | 2016-05-22 09:02 | 1.2M | |
| MTS 30s Dec 2017.pptx | 2017-12-20 03:39 | 108K | |
| Material PF/ | 2025-07-03 10:45 | - | |
| MemEff Metric.xlsx | 2018-04-26 01:37 | 10K | |
| Memory Effects ? ?VT and the components.pptx | 2018-04-26 08:31 | 76K | |
| N. Papandreou, et.al., Drift-Tolerant MLC PCM by IBM.pdf | 2016-05-22 09:50 | 611K | |
| PCMS Component Scaling.pptx | 2011-02-17 13:28 | 68K | |
| PlaceHolderDocument/ | 2025-07-03 10:45 | - | |
| Preliminary on S37/ | 2025-07-03 10:45 | - | |
| RE a set of drift-immune cell-state metrics in IBM three bit PCM (there is another article showing sub-arrays to form drift compensate mechanism).msg | 2016-05-22 01:50 | 730K | |
| Risk Assessment and Mitigation template.pptx | 2018-05-08 05:48 | 81K | |
| S26A.xlsx | 2015-07-28 08:43 | 10K | |
| S37 POR risk assessment and mitigation ideas.xlsx | 2015-05-08 01:53 | 14K | |
| S37 Product scaling.xlsx | 2015-09-26 02:10 | 35K | |
| S37 Scaling options.xlsx | 2016-03-16 05:10 | 12K | |
| S37 architecture (conflicting version 1 created on DKAU-MOBL3-635757).xlsx | 2015-07-10 09:10 | 20K | |
| S37 architecture (conflicting version 2 created on DKAU-MOBL6).xlsx | 2015-09-16 06:18 | 20K | |
| S37 architecture.xlsx | 2015-07-10 09:10 | 20K | |
| Scaling.xls | 2019-03-05 02:44 | 139K | |
| Tile Size and scaling implication.ppt | 2009-02-05 08:28 | 126K | |
| XP03 resistance evaluations/ | 2025-07-03 10:45 | - | |
| current scaling.ppt | 2009-02-02 04:48 | 237K | |
| dram design competitive landscape.xlsx | 2017-11-01 07:19 | 13K | |
| ibm-macronix 256Mb PCM 533MBps DDR2.pdf | 2016-05-21 07:26 | 1.7M | |
| map day summary.pptx | 2018-10-04 00:39 | 64K | |
| memory effect 1page.xlsx | 2018-04-26 07:55 | 13K | |
| metal system scales.ppt | 2009-02-01 08:03 | 109K | |
| path finding laundry lists.xlsx | 2017-09-25 23:10 | 214K | |
| quad pich shrink path.pptx | 2017-12-27 06:01 | 48K | |
| scaleability.xls.pptx | 2018-03-21 23:00 | 49K | |
| w thickness.xmcd | 2018-04-19 11:40 | 53K | |
| ~$Array Map Day.xlsx | 2018-05-08 05:54 | 165 | |
| ~$DDR2-4 speed.xlsx | 2019-04-19 01:07 | 165 | |
| ~$Device RARM.pptx | 2019-04-04 00:45 | 165 | |
|
|---|